C21H20FNO5S — CID 71711711
2-[6-fluoro-4-[4-(2-hydroxyethylsulfamoyl)phenyl]-3-methylnaphthalen-2-yl]acetic acid (PubChem CID 71711711) has the molecular formula C21H20FNO5S and a molecular weight of 417.46 g/mol. Its IUPAC name is 2-[6-fluoro-4-[4-(2-hydroxyethylsulfamoyl)phenyl]-3-methylnaphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-fluoro-4-[4-(2-hydroxyethylsulfamoyl)phenyl]-3-methylnaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71711711 |
| Molecular Formula | C21H20FNO5S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-[6-fluoro-4-[4-(2-hydroxyethylsulfamoyl)phenyl]-3-methylnaphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(F)cc2c1-c1ccc(S(=O)(=O)NCCO)cc1 |
| InChI | InChI=1S/C21H20FNO5S/c1-13-16(11-20(25)26)10-15-2-5-17(22)12-19(15)21(13)14-3-6-18(7-4-14)29(27,28)23-8-9-24/h2-7,10,12,23-24H,8-9,11H2,1H3,(H,25,26) |
| InChIKey | XXKTZLMYOQTQAQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |