C20H23N5O3 — CID 71717411
1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-[(E)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]urea (PubChem CID 71717411) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-[(E)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]urea.
| Compound Name | 1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-[(E)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]urea |
|---|---|
| PubChem CID | 71717411 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-3-[(E)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]urea |
| SMILES | C=C(C)[C@@H]1CC=C(C)/C(=N/NC(=O)Nc2nnc(-c3ccc(OC)cc3)o2)C1 |
| InChI | InChI=1S/C20H23N5O3/c1-12(2)15-6-5-13(3)17(11-15)22-24-19(26)21-20-25-23-18(28-20)14-7-9-16(27-4)10-8-14/h5,7-10,15H,1,6,11H2,2-4H3,(H2,21,24,25,26)/b22-17+/t15-/m1/s1 |
| InChIKey | ABKBQZADEOTGAE-HDHZYAPQSA-N |
| XLogP | 4.16 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|