C17H19F — CID 71722676
(4E)-4-[fluoro(phenyl)methylidene]spiro[4.5]dec-9-ene (PubChem CID 71722676) has the molecular formula C17H19F and a molecular weight of 242.34 g/mol. Its IUPAC name is (4E)-4-[fluoro(phenyl)methylidene]spiro[4.5]dec-9-ene.
| Compound Name | (4E)-4-[fluoro(phenyl)methylidene]spiro[4.5]dec-9-ene |
|---|---|
| PubChem CID | 71722676 |
| Molecular Formula | C17H19F |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (4E)-4-[fluoro(phenyl)methylidene]spiro[4.5]dec-9-ene |
| SMILES | F/C(=C1\CCCC12C=CCCC2)c1ccccc1 |
| InChI | InChI=1S/C17H19F/c18-16(14-8-3-1-4-9-14)15-10-7-13-17(15)11-5-2-6-12-17/h1,3-5,8-9,11H,2,6-7,10,12-13H2/b16-15+ |
| InChIKey | QUCUJMJAZJQYIO-FOCLMDBBSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|