C31H56IO7PSi — CID 71723043
[(1E,3R,4S,5S,7S,8E)-1-iodo-3-methoxy-2,4,8-trimethyl-7-tri(propan-2-yl)silyloxydodeca-1,8-dien-10-yn-5-yl] 2-diethoxyphosphorylacetate (PubChem CID 71723043) has the molecular formula C31H56IO7PSi and a molecular weight of 726.75 g/mol. Its IUPAC name is [(1E,3R,4S,5S,7S,8E)-1-iodo-3-methoxy-2,4,8-trimethyl-7-tri(propan-2-yl)silyloxydodeca-1,8-dien-10-yn-5-yl] 2-diethoxyphosphorylacetate.
| Compound Name | [(1E,3R,4S,5S,7S,8E)-1-iodo-3-methoxy-2,4,8-trimethyl-7-tri(propan-2-yl)silyloxydodeca-1,8-dien-10-yn-5-yl] 2-diethoxyphosphorylacetate |
|---|---|
| PubChem CID | 71723043 |
| Molecular Formula | C31H56IO7PSi |
| Molecular Weight | 726.75 g/mol |
| Exact Mass | 726.26 |
| IUPAC Name | [(1E,3R,4S,5S,7S,8E)-1-iodo-3-methoxy-2,4,8-trimethyl-7-tri(propan-2-yl)silyloxydodeca-1,8-dien-10-yn-5-yl] 2-diethoxyphosphorylacetate |
| SMILES | CC#C/C=C(\C)[C@H](C[C@H](OC(=O)CP(=O)(OCC)OCC)[C@H](C)[C@@H](OC)/C(C)=C/I)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H56IO7PSi/c1-14-17-18-25(10)28(39-41(22(4)5,23(6)7)24(8)9)19-29(27(12)31(35-13)26(11)20-32)38-30(33)21-40(34,36-15-2)37-16-3/h18,20,22-24,27-29,31H,15-16,19,21H2,1-13H3/b25-18+,26-20+/t27-,28-,29-,31-/m0/s1 |
| InChIKey | WZOFXYAGIVQEDZ-TWECBAFZSA-N |
| XLogP | 9.07 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.75 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|