C35H70IO8PSi2 — CID 101152827
[(1E,3S,5S,6R,7R,8E)-3-[tert-butyl(dimethyl)silyl]oxy-1-iodo-7-methoxy-2,6,8-trimethyl-10-tri(propan-2-yl)silyloxydeca-1,8-dien-5-yl] 2-diethoxyphosphorylacetate (PubChem CID 101152827) has the molecular formula C35H70IO8PSi2 and a molecular weight of 832.99 g/mol. Its IUPAC name is [(1E,3S,5S,6R,7R,8E)-3-[tert-butyl(dimethyl)silyl]oxy-1-iodo-7-methoxy-2,6,8-trimethyl-10-tri(propan-2-yl)silyloxydeca-1,8-dien-5-yl] 2-diethoxyphosphorylacetate.
| Compound Name | [(1E,3S,5S,6R,7R,8E)-3-[tert-butyl(dimethyl)silyl]oxy-1-iodo-7-methoxy-2,6,8-trimethyl-10-tri(propan-2-yl)silyloxydeca-1,8-dien-5-yl] 2-diethoxyphosphorylacetate |
|---|---|
| PubChem CID | 101152827 |
| Molecular Formula | C35H70IO8PSi2 |
| Molecular Weight | 832.99 g/mol |
| Exact Mass | 832.34 |
| IUPAC Name | [(1E,3S,5S,6R,7R,8E)-3-[tert-butyl(dimethyl)silyl]oxy-1-iodo-7-methoxy-2,6,8-trimethyl-10-tri(propan-2-yl)silyloxydeca-1,8-dien-5-yl] 2-diethoxyphosphorylacetate |
| SMILES | CCOP(=O)(CC(=O)O[C@@H](C[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/I)[C@@H](C)[C@@H](OC)/C(C)=C/CO[Si](C(C)C)(C(C)C)C(C)C)OCC |
| InChI | InChI=1S/C35H70IO8PSi2/c1-18-40-45(38,41-19-2)24-33(37)43-32(22-31(29(10)23-36)44-46(16,17)35(12,13)14)30(11)34(39-15)28(9)20-21-42-47(25(3)4,26(5)6)27(7)8/h20,23,25-27,30-32,34H,18-19,21-22,24H2,1-17H3/b28-20+,29-23+/t30-,31+,32+,34+/m1/s1 |
| InChIKey | JZDNCCNANYJNHZ-PTWDXHNLSA-N |
| XLogP | 11.07 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.99 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|