C13H7ClN4O2 — CID 71723445
9-chloro-5-nitro-2,3-dihydropyrazolo[3,4-c]carbazole (PubChem CID 71723445) has the molecular formula C13H7ClN4O2 and a molecular weight of 286.68 g/mol. Its IUPAC name is 9-chloro-5-nitro-2,3-dihydropyrazolo[3,4-c]carbazole.
| Compound Name | 9-chloro-5-nitro-2,3-dihydropyrazolo[3,4-c]carbazole |
|---|---|
| PubChem CID | 71723445 |
| Molecular Formula | C13H7ClN4O2 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 9-chloro-5-nitro-2,3-dihydropyrazolo[3,4-c]carbazole |
| SMILES | O=[N+]([O-])c1cc2[nH][nH]cc2c2c1nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C13H7ClN4O2/c14-6-1-2-9-7(3-6)12-8-5-15-17-10(8)4-11(18(19)20)13(12)16-9/h1-5,15,17H |
| InChIKey | GFCRIHVISJBYKW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|