C64H56O11 — CID 71725630
[7-methoxy-4-oxo-2-(4-phenylmethoxyphenyl)-6-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]chromen-5-yl] benzoate (PubChem CID 71725630) has the molecular formula C64H56O11 and a molecular weight of 1001.14 g/mol. Its IUPAC name is [7-methoxy-4-oxo-2-(4-phenylmethoxyphenyl)-6-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]chromen-5-yl] benzoate.
| Compound Name | [7-methoxy-4-oxo-2-(4-phenylmethoxyphenyl)-6-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]chromen-5-yl] benzoate |
|---|---|
| PubChem CID | 71725630 |
| Molecular Formula | C64H56O11 |
| Molecular Weight | 1001.14 g/mol |
| Exact Mass | 1000.38 |
| IUPAC Name | [7-methoxy-4-oxo-2-(4-phenylmethoxyphenyl)-6-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]chromen-5-yl] benzoate |
| SMILES | COc1cc2oc(-c3ccc(OCc4ccccc4)cc3)cc(=O)c2c(OC(=O)c2ccccc2)c1[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C64H56O11/c1-67-54-37-55-57(52(65)36-53(73-55)49-32-34-51(35-33-49)69-39-45-22-10-3-11-23-45)60(75-64(66)50-30-18-7-19-31-50)58(54)61-63(72-42-48-28-16-6-17-29-48)62(71-41-47-26-14-5-15-27-47)59(70-40-46-24-12-4-13-25-46)56(74-61)43-68-38-44-20-8-2-9-21-44/h2-37,56,59,61-63H,38-43H2,1H3/t56-,59-,61+,62+,63+/m1/s1 |
| InChIKey | GMQAAGNXTKMTLC-LXVQLMPCSA-N |
| XLogP | 12.68 |
| TPSA | 121.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.14 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|