C48H44O11 — CID 46915997
1,3,7-trihydroxy-6-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]xanthen-9-one (PubChem CID 46915997) has the molecular formula C48H44O11 and a molecular weight of 796.87 g/mol. Its IUPAC name is 1,3,7-trihydroxy-6-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]xanthen-9-one.
| Compound Name | 1,3,7-trihydroxy-6-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]xanthen-9-one |
|---|---|
| PubChem CID | 46915997 |
| Molecular Formula | C48H44O11 |
| Molecular Weight | 796.87 g/mol |
| Exact Mass | 796.29 |
| IUPAC Name | 1,3,7-trihydroxy-6-methoxy-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]xanthen-9-one |
| SMILES | COc1cc2oc3c([C@@H]4O[C@H](COCc5ccccc5)[C@@H](OCc5ccccc5)[C@H](OCc5ccccc5)[C@H]4OCc4ccccc4)c(O)cc(O)c3c(=O)c2cc1O |
| InChI | InChI=1S/C48H44O11/c1-53-39-24-38-34(22-35(39)49)43(52)41-36(50)23-37(51)42(45(41)58-38)46-48(57-28-33-20-12-5-13-21-33)47(56-27-32-18-10-4-11-19-32)44(55-26-31-16-8-3-9-17-31)40(59-46)29-54-25-30-14-6-2-7-15-30/h2-24,40,44,46-51H,25-29H2,1H3/t40-,44-,46+,47+,48+/m1/s1 |
| InChIKey | NTLSPSRGHHYVPY-VKNHHUHESA-N |
| XLogP | 8.48 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.87 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|