C52H46O9 — CID 10581269
4-methoxy-7-phenyl-9-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]furo[3,2-g]chromen-5-one (PubChem CID 10581269) has the molecular formula C52H46O9 and a molecular weight of 814.93 g/mol. Its IUPAC name is 4-methoxy-7-phenyl-9-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]furo[3,2-g]chromen-5-one.
| Compound Name | 4-methoxy-7-phenyl-9-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]furo[3,2-g]chromen-5-one |
|---|---|
| PubChem CID | 10581269 |
| Molecular Formula | C52H46O9 |
| Molecular Weight | 814.93 g/mol |
| Exact Mass | 814.31 |
| IUPAC Name | 4-methoxy-7-phenyl-9-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]furo[3,2-g]chromen-5-one |
| SMILES | COc1c2ccoc2c([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c2oc(-c3ccccc3)cc(=O)c12 |
| InChI | InChI=1S/C52H46O9/c1-54-46-40-27-28-56-47(40)45(49-44(46)41(53)29-42(60-49)39-25-15-6-16-26-39)50-52(59-33-38-23-13-5-14-24-38)51(58-32-37-21-11-4-12-22-37)48(57-31-36-19-9-3-10-20-36)43(61-50)34-55-30-35-17-7-2-8-18-35/h2-29,43,48,50-52H,30-34H2,1H3/t43-,48-,50+,51+,52+/m1/s1 |
| InChIKey | CIJNJFFOQDCHDX-KNJFJAKGSA-N |
| XLogP | 10.63 |
| TPSA | 98.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.93 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |