C25H22O2 — CID 71725840
(1R,5S,7Z)-7-benzylidene-1,5-diphenyl-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 71725840) has the molecular formula C25H22O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (1R,5S,7Z)-7-benzylidene-1,5-diphenyl-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1R,5S,7Z)-7-benzylidene-1,5-diphenyl-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 71725840 |
| Molecular Formula | C25H22O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (1R,5S,7Z)-7-benzylidene-1,5-diphenyl-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | C(=C1\O[C@@]2(c3ccccc3)CCC[C@]1(c1ccccc1)O2)\c1ccccc1 |
| InChI | InChI=1S/C25H22O2/c1-4-11-20(12-5-1)19-23-24(21-13-6-2-7-14-21)17-10-18-25(26-23,27-24)22-15-8-3-9-16-22/h1-9,11-16,19H,10,17-18H2/b23-19-/t24-,25+/m1/s1 |
| InChIKey | WXZMZIZICBMIEM-OLKDFDANSA-N |
| XLogP | 6.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |