C27H26N2O5 — CID 71727734
(5R)-5-benzyl-N-[(4-methoxyphenyl)methyl]-2,4-dioxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide (PubChem CID 71727734) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is (5R)-5-benzyl-N-[(4-methoxyphenyl)methyl]-2,4-dioxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide.
| Compound Name | (5R)-5-benzyl-N-[(4-methoxyphenyl)methyl]-2,4-dioxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 71727734 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (5R)-5-benzyl-N-[(4-methoxyphenyl)methyl]-2,4-dioxo-3-[(1R)-1-phenylethyl]-1,3-oxazolidine-5-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@@]2(Cc3ccccc3)OC(=O)N([C@H](C)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H26N2O5/c1-19(22-11-7-4-8-12-22)29-25(31)27(34-26(29)32,17-20-9-5-3-6-10-20)24(30)28-18-21-13-15-23(33-2)16-14-21/h3-16,19H,17-18H2,1-2H3,(H,28,30)/t19-,27-/m1/s1 |
| InChIKey | QRGYLDUMOLMZRF-XHCCPWGMSA-N |
| XLogP | 4.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|