C31H58O5 — CID 71728435
[(2S)-2-decanoyloxy-3-hydroxypropyl] (Z)-octadec-9-enoate (PubChem CID 71728435) has the molecular formula C31H58O5 and a molecular weight of 510.80 g/mol. Its IUPAC name is [(2S)-2-decanoyloxy-3-hydroxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [(2S)-2-decanoyloxy-3-hydroxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 71728435 |
| Molecular Formula | C31H58O5 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.43 |
| IUPAC Name | [(2S)-2-decanoyloxy-3-hydroxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C31H58O5/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-21-23-25-30(33)35-28-29(27-32)36-31(34)26-24-22-19-10-8-6-4-2/h14-15,29,32H,3-13,16-28H2,1-2H3/b15-14-/t29-/m0/s1 |
| InChIKey | QORDPBOHDCIDSN-RIHFKXFCSA-N |
| XLogP | 8.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|