C15H14O7 — CID 71734514
(2S,3S)-1-(2,4-dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)-2,3-dihydroxypropan-1-one (PubChem CID 71734514) has the molecular formula C15H14O7 and a molecular weight of 306.27 g/mol. Its IUPAC name is (2S,3S)-1-(2,4-dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)-2,3-dihydroxypropan-1-one.
| Compound Name | (2S,3S)-1-(2,4-dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)-2,3-dihydroxypropan-1-one |
|---|---|
| PubChem CID | 71734514 |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (2S,3S)-1-(2,4-dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)-2,3-dihydroxypropan-1-one |
| SMILES | O=C(c1ccc(O)cc1O)[C@@H](O)[C@@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H14O7/c16-8-2-3-9(11(18)6-8)14(21)15(22)13(20)7-1-4-10(17)12(19)5-7/h1-6,13,15-20,22H/t13-,15-/m0/s1 |
| InChIKey | MAUSHAULMFNBKA-ZFWWWQNUSA-N |
| XLogP | 0.79 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|