C16H12BCl2NO4 — CID 71747105
3-(2,4-dichlorophenyl)-12-methoxy-2,4-dioxa-7-azonia-3-boranuidatricyclo[7.4.0.03,7]trideca-1(9),7,10,12-tetraen-5-one (PubChem CID 71747105) has the molecular formula C16H12BCl2NO4 and a molecular weight of 363.99 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-12-methoxy-2,4-dioxa-7-azonia-3-boranuidatricyclo[7.4.0.03,7]trideca-1(9),7,10,12-tetraen-5-one.
| Compound Name | 3-(2,4-dichlorophenyl)-12-methoxy-2,4-dioxa-7-azonia-3-boranuidatricyclo[7.4.0.03,7]trideca-1(9),7,10,12-tetraen-5-one |
|---|---|
| PubChem CID | 71747105 |
| Molecular Formula | C16H12BCl2NO4 |
| Molecular Weight | 363.99 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-12-methoxy-2,4-dioxa-7-azonia-3-boranuidatricyclo[7.4.0.03,7]trideca-1(9),7,10,12-tetraen-5-one |
| SMILES | COc1ccc2c(c1)O[B-]1(c3ccc(Cl)cc3Cl)OC(=O)C[N+]1=C2 |
| InChI | InChI=1S/C16H12BCl2NO4/c1-22-12-4-2-10-8-20-9-16(21)24-17(20,23-15(10)7-12)13-5-3-11(18)6-14(13)19/h2-8H,9H2,1H3 |
| InChIKey | PALWUQSUQGPRMH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.99 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|