C20H17CoNO3 — CID 71747155
cobalt(2+);4-[(2-oxido-1,2-diphenylethylidene)amino]phenolate;hydrate (PubChem CID 71747155) has the molecular formula C20H17CoNO3 and a molecular weight of 378.29 g/mol. Its IUPAC name is cobalt(2+);4-[(2-oxido-1,2-diphenylethylidene)amino]phenolate;hydrate.
| Compound Name | cobalt(2+);4-[(2-oxido-1,2-diphenylethylidene)amino]phenolate;hydrate |
|---|---|
| PubChem CID | 71747155 |
| Molecular Formula | C20H17CoNO3 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | cobalt(2+);4-[(2-oxido-1,2-diphenylethylidene)amino]phenolate;hydrate |
| SMILES | O.[Co+2].[O-]c1ccc(/N=C(/c2ccccc2)C([O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16NO2.Co.H2O/c22-18-13-11-17(12-14-18)21-19(15-7-3-1-4-8-15)20(23)16-9-5-2-6-10-16;;/h1-14,20,22H;;1H2/q-1;+2;/p-1/b21-19-;; |
| InChIKey | YLLPONKXDOAUAQ-KSTMOPHVSA-M |
| XLogP | 2.16 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|