C15H20O8 — CID 71769999
3-O-[(1S,4S)-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl] 1-O-methyl 2-(1,3-dioxolan-2-ylidene)propanedioate (PubChem CID 71769999) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is 3-O-[(1S,4S)-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl] 1-O-methyl 2-(1,3-dioxolan-2-ylidene)propanedioate.
| Compound Name | 3-O-[(1S,4S)-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl] 1-O-methyl 2-(1,3-dioxolan-2-ylidene)propanedioate |
|---|---|
| PubChem CID | 71769999 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-O-[(1S,4S)-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl] 1-O-methyl 2-(1,3-dioxolan-2-ylidene)propanedioate |
| SMILES | COCO[C@]1(C)C=C[C@@H](OC(=O)C(C(=O)OC)=C2OCCO2)C1 |
| InChI | InChI=1S/C15H20O8/c1-15(22-9-18-2)5-4-10(8-15)23-13(17)11(12(16)19-3)14-20-6-7-21-14/h4-5,10H,6-9H2,1-3H3/t10-,15-/m1/s1 |
| InChIKey | SZBMLHAMLZZUCC-MEBBXXQBSA-N |
| XLogP | 0.67 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|