C16H17NO4 — CID 163297842
methyl (1R,8S,11S)-11-acetyloxy-8-methyl-3-azatricyclo[6.4.0.02,7]dodeca-2(7),3,5,9-tetraene-1-carboxylate (PubChem CID 163297842) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is methyl (1R,8S,11S)-11-acetyloxy-8-methyl-3-azatricyclo[6.4.0.02,7]dodeca-2(7),3,5,9-tetraene-1-carboxylate.
| Compound Name | methyl (1R,8S,11S)-11-acetyloxy-8-methyl-3-azatricyclo[6.4.0.02,7]dodeca-2(7),3,5,9-tetraene-1-carboxylate |
|---|---|
| PubChem CID | 163297842 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl (1R,8S,11S)-11-acetyloxy-8-methyl-3-azatricyclo[6.4.0.02,7]dodeca-2(7),3,5,9-tetraene-1-carboxylate |
| SMILES | COC(=O)[C@]12C[C@H](OC(C)=O)C=C[C@@]1(C)c1cccnc12 |
| InChI | InChI=1S/C16H17NO4/c1-10(18)21-11-6-7-15(2)12-5-4-8-17-13(12)16(15,9-11)14(19)20-3/h4-8,11H,9H2,1-3H3/t11-,15+,16-/m1/s1 |
| InChIKey | MGNCFOVYMRJPII-XFBWCDHKSA-N |
| XLogP | 1.66 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|