C12H16O4 — CID 71770136
[(1S,4S)-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl] buta-2,3-dienoate (PubChem CID 71770136) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is [(1S,4S)-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl] buta-2,3-dienoate.
| Compound Name | [(1S,4S)-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl] buta-2,3-dienoate |
|---|---|
| PubChem CID | 71770136 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [(1S,4S)-4-(methoxymethoxy)-4-methylcyclopent-2-en-1-yl] buta-2,3-dienoate |
| SMILES | C=C=CC(=O)O[C@@H]1C=C[C@@](C)(OCOC)C1 |
| InChI | InChI=1S/C12H16O4/c1-4-5-11(13)16-10-6-7-12(2,8-10)15-9-14-3/h5-7,10H,1,8-9H2,2-3H3/t10-,12-/m1/s1 |
| InChIKey | VNUTWVJBJISTBF-ZYHUDNBSSA-N |
| XLogP | 1.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|