C11H20O4 — CID 71770343
1-[(2R,3S,4R,6S)-3,4-dihydroxy-6-propyloxan-2-yl]propan-2-one (PubChem CID 71770343) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-[(2R,3S,4R,6S)-3,4-dihydroxy-6-propyloxan-2-yl]propan-2-one.
| Compound Name | 1-[(2R,3S,4R,6S)-3,4-dihydroxy-6-propyloxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 71770343 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-[(2R,3S,4R,6S)-3,4-dihydroxy-6-propyloxan-2-yl]propan-2-one |
| SMILES | CCC[C@H]1C[C@@H](O)[C@H](O)[C@@H](CC(C)=O)O1 |
| InChI | InChI=1S/C11H20O4/c1-3-4-8-6-9(13)11(14)10(15-8)5-7(2)12/h8-11,13-14H,3-6H2,1-2H3/t8-,9+,10+,11-/m0/s1 |
| InChIKey | VNJOJEJARUEZQD-ZDCRXTMVSA-N |
| XLogP | 0.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |