C13H16ClNO5 — CID 71773534
benzyl N-[(2S)-5-chloro-3,3-dihydroxy-4-oxopentan-2-yl]carbamate (PubChem CID 71773534) has the molecular formula C13H16ClNO5 and a molecular weight of 301.73 g/mol. Its IUPAC name is benzyl N-[(2S)-5-chloro-3,3-dihydroxy-4-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-chloro-3,3-dihydroxy-4-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 71773534 |
| Molecular Formula | C13H16ClNO5 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | benzyl N-[(2S)-5-chloro-3,3-dihydroxy-4-oxopentan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(O)(O)C(=O)CCl |
| InChI | InChI=1S/C13H16ClNO5/c1-9(13(18,19)11(16)7-14)15-12(17)20-8-10-5-3-2-4-6-10/h2-6,9,18-19H,7-8H2,1H3,(H,15,17)/t9-/m0/s1 |
| InChIKey | XHTTTWLZYWZDSH-VIFPVBQESA-N |
| XLogP | 0.79 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|