C20H16BrN3OS — CID 71809948
6-bromo-2-methyl-N-[(2-thiophen-3-ylphenyl)methyl]indazole-3-carboxamide (PubChem CID 71809948) has the molecular formula C20H16BrN3OS and a molecular weight of 426.34 g/mol. Its IUPAC name is 6-bromo-2-methyl-N-[(2-thiophen-3-ylphenyl)methyl]indazole-3-carboxamide.
| Compound Name | 6-bromo-2-methyl-N-[(2-thiophen-3-ylphenyl)methyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 71809948 |
| Molecular Formula | C20H16BrN3OS |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 6-bromo-2-methyl-N-[(2-thiophen-3-ylphenyl)methyl]indazole-3-carboxamide |
| SMILES | Cn1nc2cc(Br)ccc2c1C(=O)NCc1ccccc1-c1ccsc1 |
| InChI | InChI=1S/C20H16BrN3OS/c1-24-19(17-7-6-15(21)10-18(17)23-24)20(25)22-11-13-4-2-3-5-16(13)14-8-9-26-12-14/h2-10,12H,11H2,1H3,(H,22,25) |
| InChIKey | AJCPCUFLCGZSOK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |