C18H18F2N4O4S — CID 71850153
N'-[(2,5-difluorophenyl)methyl]-4-(3-oxopiperazin-1-yl)sulfonylbenzohydrazide (PubChem CID 71850153) has the molecular formula C18H18F2N4O4S and a molecular weight of 424.43 g/mol. Its IUPAC name is N'-[(2,5-difluorophenyl)methyl]-4-(3-oxopiperazin-1-yl)sulfonylbenzohydrazide.
| Compound Name | N'-[(2,5-difluorophenyl)methyl]-4-(3-oxopiperazin-1-yl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 71850153 |
| Molecular Formula | C18H18F2N4O4S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N'-[(2,5-difluorophenyl)methyl]-4-(3-oxopiperazin-1-yl)sulfonylbenzohydrazide |
| SMILES | O=C1CN(S(=O)(=O)c2ccc(C(=O)NNCc3cc(F)ccc3F)cc2)CCN1 |
| InChI | InChI=1S/C18H18F2N4O4S/c19-14-3-6-16(20)13(9-14)10-22-23-18(26)12-1-4-15(5-2-12)29(27,28)24-8-7-21-17(25)11-24/h1-6,9,22H,7-8,10-11H2,(H,21,25)(H,23,26) |
| InChIKey | ZFNJWXKTFVQGBO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|