C18H22N2O4S2 — CID 71850838
3-[(2-propyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzenesulfonamide (PubChem CID 71850838) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-[(2-propyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzenesulfonamide.
| Compound Name | 3-[(2-propyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71850838 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 3-[(2-propyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]benzenesulfonamide |
| SMILES | CCCC1CCc2ccccc2N1S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-2-6-15-12-11-14-7-3-4-10-18(14)20(15)26(23,24)17-9-5-8-16(13-17)25(19,21)22/h3-5,7-10,13,15H,2,6,11-12H2,1H3,(H2,19,21,22) |
| InChIKey | IFHGMOVPTPDNLH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |