C12H16N2O3 — CID 71859605
pent-4-yn-2-yl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate (PubChem CID 71859605) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is pent-4-yn-2-yl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate.
| Compound Name | pent-4-yn-2-yl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 71859605 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | pent-4-yn-2-yl 5-methoxy-1,3-dimethylpyrazole-4-carboxylate |
| SMILES | C#CCC(C)OC(=O)c1c(C)nn(C)c1OC |
| InChI | InChI=1S/C12H16N2O3/c1-6-7-8(2)17-12(15)10-9(3)13-14(4)11(10)16-5/h1,8H,7H2,2-5H3 |
| InChIKey | PAWFVLSJQHSPMH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|