C17H18N4O5 — CID 71868553
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 71868553) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate |
|---|---|
| PubChem CID | 71868553 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)propanoate |
| SMILES | O=C(COC(=O)CCc1nc(C2CC2)no1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18N4O5/c22-13(19-20-17(24)12-4-2-1-3-5-12)10-25-15(23)9-8-14-18-16(21-26-14)11-6-7-11/h1-5,11H,6-10H2,(H,19,22)(H,20,24) |
| InChIKey | XWSTVRKSIOOXEW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|