C19H19ClN2S — CID 71885974
1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-3-(2,3-dihydro-1H-inden-5-yl)thiourea (PubChem CID 71885974) has the molecular formula C19H19ClN2S and a molecular weight of 342.89 g/mol. Its IUPAC name is 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-3-(2,3-dihydro-1H-inden-5-yl)thiourea.
| Compound Name | 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-3-(2,3-dihydro-1H-inden-5-yl)thiourea |
|---|---|
| PubChem CID | 71885974 |
| Molecular Formula | C19H19ClN2S |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-3-(2,3-dihydro-1H-inden-5-yl)thiourea |
| SMILES | S=C(Nc1ccc2c(c1)CCC2)NC1CCc2c(Cl)cccc21 |
| InChI | InChI=1S/C19H19ClN2S/c20-17-6-2-5-16-15(17)9-10-18(16)22-19(23)21-14-8-7-12-3-1-4-13(12)11-14/h2,5-8,11,18H,1,3-4,9-10H2,(H2,21,22,23) |
| InChIKey | HIZFRAXEBNKESG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|