C20H24N2O3S — CID 71888709
3-(1,3-benzothiazol-2-yl)propyl 1-cyclopentyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 71888709) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)propyl 1-cyclopentyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | 3-(1,3-benzothiazol-2-yl)propyl 1-cyclopentyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 71888709 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)propyl 1-cyclopentyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(OCCCc1nc2ccccc2s1)C1CC(=O)N(C2CCCC2)C1 |
| InChI | InChI=1S/C20H24N2O3S/c23-19-12-14(13-22(19)15-6-1-2-7-15)20(24)25-11-5-10-18-21-16-8-3-4-9-17(16)26-18/h3-4,8-9,14-15H,1-2,5-7,10-13H2 |
| InChIKey | DEFXJCMEUKXGQN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|