C16H10F4N4OS — CID 71891871
N-[2-fluoro-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]thiophene-3-carboxamide (PubChem CID 71891871) has the molecular formula C16H10F4N4OS and a molecular weight of 382.34 g/mol. Its IUPAC name is N-[2-fluoro-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]thiophene-3-carboxamide.
| Compound Name | N-[2-fluoro-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 71891871 |
| Molecular Formula | C16H10F4N4OS |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | N-[2-fluoro-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1cc(Nc2nccc(C(F)(F)F)n2)ccc1F)c1ccsc1 |
| InChI | InChI=1S/C16H10F4N4OS/c17-11-2-1-10(7-12(11)23-14(25)9-4-6-26-8-9)22-15-21-5-3-13(24-15)16(18,19)20/h1-8H,(H,23,25)(H,21,22,24) |
| InChIKey | MRJPAQBKYDRUNJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |