C18H18FN3O4S — CID 71894849
N'-[4-fluoro-3-(thiophene-3-carbonylamino)phenyl]-N-(oxolan-2-ylmethyl)oxamide (PubChem CID 71894849) has the molecular formula C18H18FN3O4S and a molecular weight of 391.42 g/mol. Its IUPAC name is N'-[4-fluoro-3-(thiophene-3-carbonylamino)phenyl]-N-(oxolan-2-ylmethyl)oxamide.
| Compound Name | N'-[4-fluoro-3-(thiophene-3-carbonylamino)phenyl]-N-(oxolan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 71894849 |
| Molecular Formula | C18H18FN3O4S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N'-[4-fluoro-3-(thiophene-3-carbonylamino)phenyl]-N-(oxolan-2-ylmethyl)oxamide |
| SMILES | O=C(NCC1CCCO1)C(=O)Nc1ccc(F)c(NC(=O)c2ccsc2)c1 |
| InChI | InChI=1S/C18H18FN3O4S/c19-14-4-3-12(8-15(14)22-16(23)11-5-7-27-10-11)21-18(25)17(24)20-9-13-2-1-6-26-13/h3-5,7-8,10,13H,1-2,6,9H2,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | MQTBRUOPLVJZBU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|