C19H14N4O2S — CID 71894798
N-(1,3-benzothiazol-2-ylmethyl)-N'-quinolin-5-yloxamide (PubChem CID 71894798) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-N'-quinolin-5-yloxamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-N'-quinolin-5-yloxamide |
|---|---|
| PubChem CID | 71894798 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-N'-quinolin-5-yloxamide |
| SMILES | O=C(NCc1nc2ccccc2s1)C(=O)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C19H14N4O2S/c24-18(21-11-17-22-15-6-1-2-9-16(15)26-17)19(25)23-14-8-3-7-13-12(14)5-4-10-20-13/h1-10H,11H2,(H,21,24)(H,23,25) |
| InChIKey | SPWHNYVUYBMKRH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|