C18H20N2O3 — CID 71903308
N-(8-tricyclo[5.2.1.02,6]decanylideneamino)-1,3-benzodioxole-5-carboxamide (PubChem CID 71903308) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(8-tricyclo[5.2.1.02,6]decanylideneamino)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(8-tricyclo[5.2.1.02,6]decanylideneamino)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 71903308 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-(8-tricyclo[5.2.1.02,6]decanylideneamino)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NN=C1CC2CC1C1CCCC21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20N2O3/c21-18(10-4-5-16-17(8-10)23-9-22-16)20-19-15-7-11-6-14(15)13-3-1-2-12(11)13/h4-5,8,11-14H,1-3,6-7,9H2,(H,20,21) |
| InChIKey | RPWFBEZENPCOCE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|