C18H14F2N2O4S — CID 71903520
2-cyano-3-[5-(difluoromethylsulfanylmethyl)furan-2-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide (PubChem CID 71903520) has the molecular formula C18H14F2N2O4S and a molecular weight of 392.38 g/mol. Its IUPAC name is 2-cyano-3-[5-(difluoromethylsulfanylmethyl)furan-2-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[5-(difluoromethylsulfanylmethyl)furan-2-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 71903520 |
| Molecular Formula | C18H14F2N2O4S |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-cyano-3-[5-(difluoromethylsulfanylmethyl)furan-2-yl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(CSC(F)F)o1)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H14F2N2O4S/c19-18(20)27-10-14-3-2-13(26-14)7-11(9-21)17(23)22-12-1-4-15-16(8-12)25-6-5-24-15/h1-4,7-8,18H,5-6,10H2,(H,22,23) |
| InChIKey | NAHMQRHIMWXVAS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|