C20H23N2O6- — CID 7190681
4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-prop-2-enylamino]-4-oxobutanoate (PubChem CID 7190681) has the molecular formula C20H23N2O6- and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-prop-2-enylamino]-4-oxobutanoate.
| Compound Name | 4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-prop-2-enylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 7190681 |
| Molecular Formula | C20H23N2O6- |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-[[(3R)-2,5-dioxo-1-(4-propoxyphenyl)pyrrolidin-3-yl]-prop-2-enylamino]-4-oxobutanoate |
| SMILES | C=CCN(C(=O)CCC(=O)[O-])[C@@H]1CC(=O)N(c2ccc(OCCC)cc2)C1=O |
| InChI | InChI=1S/C20H24N2O6/c1-3-11-21(17(23)9-10-19(25)26)16-13-18(24)22(20(16)27)14-5-7-15(8-6-14)28-12-4-2/h3,5-8,16H,1,4,9-13H2,2H3,(H,25,26)/p-1/t16-/m1/s1 |
| InChIKey | WBZMBZDTVBIDTI-MRXNPFEDSA-M |
| XLogP | 0.65 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|