C17H20N2O5 — CID 71942506
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-(2,3-dihydro-1-benzofuran-5-yl)acetate (PubChem CID 71942506) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-(2,3-dihydro-1-benzofuran-5-yl)acetate.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-(2,3-dihydro-1-benzofuran-5-yl)acetate |
|---|---|
| PubChem CID | 71942506 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-(2,3-dihydro-1-benzofuran-5-yl)acetate |
| SMILES | CC1(C)NC(=O)N(CCOC(=O)Cc2ccc3c(c2)CCO3)C1=O |
| InChI | InChI=1S/C17H20N2O5/c1-17(2)15(21)19(16(22)18-17)6-8-24-14(20)10-11-3-4-13-12(9-11)5-7-23-13/h3-4,9H,5-8,10H2,1-2H3,(H,18,22) |
| InChIKey | KLEPTONCFNXTQM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|