C20H18FNO3 — CID 71944511
3-[5-(2-fluorophenyl)furan-2-yl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide (PubChem CID 71944511) has the molecular formula C20H18FNO3 and a molecular weight of 339.37 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)furan-2-yl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide.
| Compound Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 71944511 |
| Molecular Formula | C20H18FNO3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]prop-2-enamide |
| SMILES | Cc1ccc(CN(C)C(=O)C=Cc2ccc(-c3ccccc3F)o2)o1 |
| InChI | InChI=1S/C20H18FNO3/c1-14-7-8-16(24-14)13-22(2)20(23)12-10-15-9-11-19(25-15)17-5-3-4-6-18(17)21/h3-12H,13H2,1-2H3 |
| InChIKey | CSXAKRAIWXQQQO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|