C11H19N3O4S2 — CID 71945599
N-[3-(hydrazinesulfonyl)-2,4,6-trimethylphenyl]-N-methylmethanesulfonamide (PubChem CID 71945599) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[3-(hydrazinesulfonyl)-2,4,6-trimethylphenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[3-(hydrazinesulfonyl)-2,4,6-trimethylphenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 71945599 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[3-(hydrazinesulfonyl)-2,4,6-trimethylphenyl]-N-methylmethanesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NN)c(C)c1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H19N3O4S2/c1-7-6-8(2)11(20(17,18)13-12)9(3)10(7)14(4)19(5,15)16/h6,13H,12H2,1-5H3 |
| InChIKey | QIETWUPJGJXONX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|