C18H19ClN4O3 — CID 71945968
1-[6-chloro-4-(3,4,5-trimethoxyphenyl)quinazolin-2-yl]-1-methylhydrazine (PubChem CID 71945968) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is 1-[6-chloro-4-(3,4,5-trimethoxyphenyl)quinazolin-2-yl]-1-methylhydrazine.
| Compound Name | 1-[6-chloro-4-(3,4,5-trimethoxyphenyl)quinazolin-2-yl]-1-methylhydrazine |
|---|---|
| PubChem CID | 71945968 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-[6-chloro-4-(3,4,5-trimethoxyphenyl)quinazolin-2-yl]-1-methylhydrazine |
| SMILES | COc1cc(-c2nc(N(C)N)nc3ccc(Cl)cc23)cc(OC)c1OC |
| InChI | InChI=1S/C18H19ClN4O3/c1-23(20)18-21-13-6-5-11(19)9-12(13)16(22-18)10-7-14(24-2)17(26-4)15(8-10)25-3/h5-9H,20H2,1-4H3 |
| InChIKey | HTNVUTBFRMBNHX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|