About N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide
N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide (PubChem CID 71972939) has the molecular formula C17H21N3OS
and a molecular weight of 315.44 g/mol. Its IUPAC name is N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide |
| PubChem CID | 71972939 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NCc2csc(C3CCCC3)n2)c1 |
| InChI | InChI=1S/C17H21N3OS/c1-12(21)19-15-8-4-7-14(9-15)18-10-16-11-22-17(20-16)13-5-2-3-6-13/h4,7-9,11,13,18H,2-3,5-6,10H2,1H3,(H,19,21) |
| InChIKey | GHXSYRJPGCLOMS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide?
The IUPAC name of N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide (CID 71972939) is N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide.
What is the SMILES notation for N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide?
The canonical SMILES for N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide is CC(=O)Nc1cccc(NCc2csc(C3CCCC3)n2)c1.
What is the InChIKey of N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide?
The InChIKey is GHXSYRJPGCLOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3OS/c1-12(21)19-15-8-4-7-14(9-15)18-10-16-11-22-17(20-16)13-5-2-3-6-13/h4,7-9,11,13,18H,2-3,5-6,10H2,1H3,(H,19,21).
What are the key properties of N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide?
N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide has a molecular weight of 315.44 g/mol, XLogP of 4.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(2-cyclopentyl-1,3-thiazol-4-yl)methylamino]phenyl]acetamide is sourced from PubChem (CID 71972939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).