C15H13N7OS — CID 71999613
3-[5-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]benzonitrile (PubChem CID 71999613) has the molecular formula C15H13N7OS and a molecular weight of 339.38 g/mol. Its IUPAC name is 3-[5-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]benzonitrile.
| Compound Name | 3-[5-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 71999613 |
| Molecular Formula | C15H13N7OS |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3-[5-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,4-oxadiazol-2-yl]benzonitrile |
| SMILES | C=CCn1c(N)nnc1SCc1nnc(-c2cccc(C#N)c2)o1 |
| InChI | InChI=1S/C15H13N7OS/c1-2-6-22-14(17)20-21-15(22)24-9-12-18-19-13(23-12)11-5-3-4-10(7-11)8-16/h2-5,7H,1,6,9H2,(H2,17,20) |
| InChIKey | PEZVXFMNOXYIJT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|