C13H11FN4O6 — CID 7211445
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate (PubChem CID 7211445) has the molecular formula C13H11FN4O6 and a molecular weight of 338.25 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 7211445 |
| Molecular Formula | C13H11FN4O6 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
| SMILES | O=C1CCC(C(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2F)=NN1 |
| InChI | InChI=1S/C13H11FN4O6/c14-8-2-1-7(18(22)23)5-10(8)15-12(20)6-24-13(21)9-3-4-11(19)17-16-9/h1-2,5H,3-4,6H2,(H,15,20)(H,17,19) |
| InChIKey | AJHWVAINVNLYAF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|