C26H26NO+ — CID 7232930
[(3S,4S,5S)-1,5-dimethyl-4,6-diphenyl-2,3,4,5-tetrahydropyridin-1-ium-3-yl]-phenylmethanone (PubChem CID 7232930) has the molecular formula C26H26NO+ and a molecular weight of 368.50 g/mol. Its IUPAC name is [(3S,4S,5S)-1,5-dimethyl-4,6-diphenyl-2,3,4,5-tetrahydropyridin-1-ium-3-yl]-phenylmethanone.
| Compound Name | [(3S,4S,5S)-1,5-dimethyl-4,6-diphenyl-2,3,4,5-tetrahydropyridin-1-ium-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7232930 |
| Molecular Formula | C26H26NO+ |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | [(3S,4S,5S)-1,5-dimethyl-4,6-diphenyl-2,3,4,5-tetrahydropyridin-1-ium-3-yl]-phenylmethanone |
| SMILES | C[C@@H]1C(c2ccccc2)=[N+](C)C[C@@H](C(=O)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H26NO/c1-19-24(20-12-6-3-7-13-20)23(26(28)22-16-10-5-11-17-22)18-27(2)25(19)21-14-8-4-9-15-21/h3-17,19,23-24H,18H2,1-2H3/q+1/t19-,23+,24+/m0/s1 |
| InChIKey | CTWBZPZGQUGJLG-WUMKDDEVSA-N |
| XLogP | 5.05 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|