C27H23N3O — CID 7237201
N'-(1-anilino-2,2-diphenylethenyl)benzohydrazide (PubChem CID 7237201) has the molecular formula C27H23N3O and a molecular weight of 405.50 g/mol. Its IUPAC name is N'-(1-anilino-2,2-diphenylethenyl)benzohydrazide.
| Compound Name | N'-(1-anilino-2,2-diphenylethenyl)benzohydrazide |
|---|---|
| PubChem CID | 7237201 |
| Molecular Formula | C27H23N3O |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N'-(1-anilino-2,2-diphenylethenyl)benzohydrazide |
| SMILES | O=C(NNC(Nc1ccccc1)=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H23N3O/c31-27(23-17-9-3-10-18-23)30-29-26(28-24-19-11-4-12-20-24)25(21-13-5-1-6-14-21)22-15-7-2-8-16-22/h1-20,28-29H,(H,30,31) |
| InChIKey | XZOUUEFCCTYBJM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|