C14H11ClN4O2S — CID 7237997
N-[(E)-(5-chlorothiophen-2-yl)methylideneamino]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide (PubChem CID 7237997) has the molecular formula C14H11ClN4O2S and a molecular weight of 334.79 g/mol. Its IUPAC name is N-[(E)-(5-chlorothiophen-2-yl)methylideneamino]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[(E)-(5-chlorothiophen-2-yl)methylideneamino]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 7237997 |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-[(E)-(5-chlorothiophen-2-yl)methylideneamino]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)s1)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C14H11ClN4O2S/c15-13-5-3-11(22-13)8-16-18-14(20)12-4-2-10(21-12)9-19-7-1-6-17-19/h1-8H,9H2,(H,18,20)/b16-8+ |
| InChIKey | CNAQZNGLGYCUIQ-LZYBPNLTSA-N |
| XLogP | 3.00 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|