C17H13ClN4O4 — CID 6873340
N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide (PubChem CID 6873340) has the molecular formula C17H13ClN4O4 and a molecular weight of 372.77 g/mol. Its IUPAC name is N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 6873340 |
| Molecular Formula | C17H13ClN4O4 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc2c(cc1Cl)OCO2)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C17H13ClN4O4/c18-13-7-16-15(24-10-25-16)6-11(13)8-19-21-17(23)14-3-2-12(26-14)9-22-5-1-4-20-22/h1-8H,9-10H2,(H,21,23)/b19-8+ |
| InChIKey | ZHJRMDPWKORTGE-UFWORHAWSA-N |
| XLogP | 2.67 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|