C10H9Cl2NOS — CID 723855
(2S,5R)-2-(3,4-dichlorophenyl)-5-methyl-1,3-thiazolidin-4-one (PubChem CID 723855) has the molecular formula C10H9Cl2NOS and a molecular weight of 262.16 g/mol. Its IUPAC name is (2S,5R)-2-(3,4-dichlorophenyl)-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | (2S,5R)-2-(3,4-dichlorophenyl)-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 723855 |
| Molecular Formula | C10H9Cl2NOS |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | (2S,5R)-2-(3,4-dichlorophenyl)-5-methyl-1,3-thiazolidin-4-one |
| SMILES | C[C@H]1S[C@@H](c2ccc(Cl)c(Cl)c2)NC1=O |
| InChI | InChI=1S/C10H9Cl2NOS/c1-5-9(14)13-10(15-5)6-2-3-7(11)8(12)4-6/h2-5,10H,1H3,(H,13,14)/t5-,10+/m1/s1 |
| InChIKey | JVILGLBJGZEDME-FWOIEVBISA-N |
| XLogP | 3.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |