C13H13Cl2NO2 — CID 70160982
(1S,5S)-1-(3,4-dichlorophenyl)-5-methyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 70160982) has the molecular formula C13H13Cl2NO2 and a molecular weight of 286.16 g/mol. Its IUPAC name is (1S,5S)-1-(3,4-dichlorophenyl)-5-methyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (1S,5S)-1-(3,4-dichlorophenyl)-5-methyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 70160982 |
| Molecular Formula | C13H13Cl2NO2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | (1S,5S)-1-(3,4-dichlorophenyl)-5-methyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | C[C@H]1CCC2[C@H](c3ccc(Cl)c(Cl)c3)OC(=O)N21 |
| InChI | InChI=1S/C13H13Cl2NO2/c1-7-2-5-11-12(18-13(17)16(7)11)8-3-4-9(14)10(15)6-8/h3-4,6-7,11-12H,2,5H2,1H3/t7-,11?,12-/m0/s1 |
| InChIKey | ZGUNOZAORIWMSN-GWPQXNRISA-N |
| XLogP | 4.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |