C14H17Cl2NO — CID 7241797
N-benzyl-4-[(1S)-2,2-dichlorocyclopropyl]butanamide (PubChem CID 7241797) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is N-benzyl-4-[(1S)-2,2-dichlorocyclopropyl]butanamide.
| Compound Name | N-benzyl-4-[(1S)-2,2-dichlorocyclopropyl]butanamide |
|---|---|
| PubChem CID | 7241797 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-benzyl-4-[(1S)-2,2-dichlorocyclopropyl]butanamide |
| SMILES | O=C(CCC[C@H]1CC1(Cl)Cl)NCc1ccccc1 |
| InChI | InChI=1S/C14H17Cl2NO/c15-14(16)9-12(14)7-4-8-13(18)17-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,17,18)/t12-/m0/s1 |
| InChIKey | JQMBRRIETFCMJW-LBPRGKRZSA-N |
| XLogP | 3.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|