C17H20N2O3 — CID 72543908
ethyl 1-(dimethylcarbamoyl)-2-prop-2-enylindole-3-carboxylate (PubChem CID 72543908) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is ethyl 1-(dimethylcarbamoyl)-2-prop-2-enylindole-3-carboxylate.
| Compound Name | ethyl 1-(dimethylcarbamoyl)-2-prop-2-enylindole-3-carboxylate |
|---|---|
| PubChem CID | 72543908 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | ethyl 1-(dimethylcarbamoyl)-2-prop-2-enylindole-3-carboxylate |
| SMILES | C=CCc1c(C(=O)OCC)c2ccccc2n1C(=O)N(C)C |
| InChI | InChI=1S/C17H20N2O3/c1-5-9-14-15(16(20)22-6-2)12-10-7-8-11-13(12)19(14)17(21)18(3)4/h5,7-8,10-11H,1,6,9H2,2-4H3 |
| InChIKey | VDKVJIZKPJPJBC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|