C21H26ClFO4 — CID 72545699
6-chloro-4,4-dicyclohexyl-7-fluoro-1,3-benzodioxine-2-carboxylic acid (PubChem CID 72545699) has the molecular formula C21H26ClFO4 and a molecular weight of 396.89 g/mol. Its IUPAC name is 6-chloro-4,4-dicyclohexyl-7-fluoro-1,3-benzodioxine-2-carboxylic acid.
| Compound Name | 6-chloro-4,4-dicyclohexyl-7-fluoro-1,3-benzodioxine-2-carboxylic acid |
|---|---|
| PubChem CID | 72545699 |
| Molecular Formula | C21H26ClFO4 |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 6-chloro-4,4-dicyclohexyl-7-fluoro-1,3-benzodioxine-2-carboxylic acid |
| SMILES | O=C(O)C1Oc2cc(F)c(Cl)cc2C(C2CCCCC2)(C2CCCCC2)O1 |
| InChI | InChI=1S/C21H26ClFO4/c22-16-11-15-18(12-17(16)23)26-20(19(24)25)27-21(15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h11-14,20H,1-10H2,(H,24,25) |
| InChIKey | NQYVUFAEKZROKZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |