C27H31ClO3 — CID 141379295
(4-chlorophenyl)-(4,4-dicyclohexyl-1,3-benzodioxin-6-yl)methanone (PubChem CID 141379295) has the molecular formula C27H31ClO3 and a molecular weight of 439.00 g/mol. Its IUPAC name is (4-chlorophenyl)-(4,4-dicyclohexyl-1,3-benzodioxin-6-yl)methanone.
| Compound Name | (4-chlorophenyl)-(4,4-dicyclohexyl-1,3-benzodioxin-6-yl)methanone |
|---|---|
| PubChem CID | 141379295 |
| Molecular Formula | C27H31ClO3 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (4-chlorophenyl)-(4,4-dicyclohexyl-1,3-benzodioxin-6-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc2c(c1)C(C1CCCCC1)(C1CCCCC1)OCO2 |
| InChI | InChI=1S/C27H31ClO3/c28-23-14-11-19(12-15-23)26(29)20-13-16-25-24(17-20)27(31-18-30-25,21-7-3-1-4-8-21)22-9-5-2-6-10-22/h11-17,21-22H,1-10,18H2 |
| InChIKey | APNLKPKQHIFDPC-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |